C15H32Y-2 — CID 58340673
carbanide;3,5,7-trimethylundecane;yttrium (PubChem CID 58340673) has the molecular formula C15H32Y-2 and a molecular weight of 301.33 g/mol. Its IUPAC name is carbanide;3,5,7-trimethylundecane;yttrium.
| Compound Name | carbanide;3,5,7-trimethylundecane;yttrium |
|---|---|
| PubChem CID | 58340673 |
| Molecular Formula | C15H32Y-2 |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | carbanide;3,5,7-trimethylundecane;yttrium |
| SMILES | [CH2-]CCCC(C)CC(C)CC(C)CC.[CH3-].[Y] |
| InChI | InChI=1S/C14H29.CH3.Y/c1-6-8-9-13(4)11-14(5)10-12(3)7-2;;/h12-14H,1,6-11H2,2-5H3;1H3;/q2*-1; |
| InChIKey | MRMNUOKWUAIFHS-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|