C17H29ClO — CID 21437736
(2E,4E)-3,8,13-trimethyltetradeca-2,4-dienoyl chloride (PubChem CID 21437736) has the molecular formula C17H29ClO and a molecular weight of 284.87 g/mol. Its IUPAC name is (2E,4E)-3,8,13-trimethyltetradeca-2,4-dienoyl chloride.
| Compound Name | (2E,4E)-3,8,13-trimethyltetradeca-2,4-dienoyl chloride |
|---|---|
| PubChem CID | 21437736 |
| Molecular Formula | C17H29ClO |
| Molecular Weight | 284.87 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | (2E,4E)-3,8,13-trimethyltetradeca-2,4-dienoyl chloride |
| SMILES | CC(/C=C/CCC(C)CCCCC(C)C)=C\C(=O)Cl |
| InChI | InChI=1S/C17H29ClO/c1-14(2)9-5-6-10-15(3)11-7-8-12-16(4)13-17(18)19/h8,12-15H,5-7,9-11H2,1-4H3/b12-8+,16-13+ |
| InChIKey | GNCJYSPKSZPLLS-UEVLXMDPSA-N |
| XLogP | 5.89 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.87 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|