C20H38O — CID 71372083
3,7,11,15-tetramethylhexadeca-1,3-dien-1-ol (PubChem CID 71372083) has the molecular formula C20H38O and a molecular weight of 294.52 g/mol. Its IUPAC name is 3,7,11,15-tetramethylhexadeca-1,3-dien-1-ol.
| Compound Name | 3,7,11,15-tetramethylhexadeca-1,3-dien-1-ol |
|---|---|
| PubChem CID | 71372083 |
| Molecular Formula | C20H38O |
| Molecular Weight | 294.52 g/mol |
| Exact Mass | 294.29 |
| IUPAC Name | 3,7,11,15-tetramethylhexadeca-1,3-dien-1-ol |
| SMILES | CC(C=CO)=CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C20H38O/c1-17(2)9-6-10-18(3)11-7-12-19(4)13-8-14-20(5)15-16-21/h14-19,21H,6-13H2,1-5H3 |
| InChIKey | SQYDCWXHVANLSG-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.52 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|