C20H40O — CID 74375943
3,7,11,15-tetramethylhexadec-1-en-1-ol (PubChem CID 74375943) has the molecular formula C20H40O and a molecular weight of 296.54 g/mol. Its IUPAC name is 3,7,11,15-tetramethylhexadec-1-en-1-ol.
| Compound Name | 3,7,11,15-tetramethylhexadec-1-en-1-ol |
|---|---|
| PubChem CID | 74375943 |
| Molecular Formula | C20H40O |
| Molecular Weight | 296.54 g/mol |
| Exact Mass | 296.31 |
| IUPAC Name | 3,7,11,15-tetramethylhexadec-1-en-1-ol |
| SMILES | CC(C)CCCC(C)CCCC(C)CCCC(C)C=CO |
| InChI | InChI=1S/C20H40O/c1-17(2)9-6-10-18(3)11-7-12-19(4)13-8-14-20(5)15-16-21/h15-21H,6-14H2,1-5H3 |
| InChIKey | BLUHKGOSFDHHGX-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.54 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|