C30H60 — CID 154734430
2,6,10,15,19,23-hexamethyltetracos-12-ene (PubChem CID 154734430) has the molecular formula C30H60 and a molecular weight of 420.81 g/mol. Its IUPAC name is 2,6,10,15,19,23-hexamethyltetracos-12-ene.
| Compound Name | 2,6,10,15,19,23-hexamethyltetracos-12-ene |
|---|---|
| PubChem CID | 154734430 |
| Molecular Formula | C30H60 |
| Molecular Weight | 420.81 g/mol |
| Exact Mass | 420.47 |
| IUPAC Name | 2,6,10,15,19,23-hexamethyltetracos-12-ene |
| SMILES | CC(C)CCCC(C)CCCC(C)CC=CCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C30H60/c1-25(2)15-11-19-29(7)23-13-21-27(5)17-9-10-18-28(6)22-14-24-30(8)20-12-16-26(3)4/h9-10,25-30H,11-24H2,1-8H3 |
| InChIKey | WFTIEJHCDSAJAF-UHFFFAOYSA-N |
| XLogP | 10.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 20 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.81 |
| LogP ≤ 5 | 10.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|