C15H30O — CID 14420009
3,7,11-trimethyldodecanal (PubChem CID 14420009) has the molecular formula C15H30O and a molecular weight of 226.40 g/mol. Its IUPAC name is 3,7,11-trimethyldodecanal.
| Compound Name | 3,7,11-trimethyldodecanal |
|---|---|
| PubChem CID | 14420009 |
| Molecular Formula | C15H30O |
| Molecular Weight | 226.40 g/mol |
| Exact Mass | 226.23 |
| IUPAC Name | 3,7,11-trimethyldodecanal |
| SMILES | CC(C)CCCC(C)CCCC(C)CC=O |
| InChI | InChI=1S/C15H30O/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-16/h12-15H,5-11H2,1-4H3 |
| InChIKey | BTCKFZHMWUFBQY-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.40 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|