About (3S)-3-methylhexanedial
(3S)-3-methylhexanedial (PubChem CID 129384452) has the molecular formula C7H12O2
and a molecular weight of 128.17 g/mol. Its IUPAC name is (3S)-3-methylhexanedial.
Molecular Properties
| Compound Name | (3S)-3-methylhexanedial |
| PubChem CID | 129384452 |
| Molecular Formula | C7H12O2 |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.08 |
| IUPAC Name | (3S)-3-methylhexanedial |
| SMILES | C[C@H](CC=O)CCC=O |
| InChI | InChI=1S/C7H12O2/c1-7(4-6-9)3-2-5-8/h5-7H,2-4H2,1H3/t7-/m0/s1 |
| InChIKey | REOYKRDMVBXLRN-ZETCQYMHSA-N |
| XLogP | 1.19 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (3S)-3-methylhexanedial with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-methylhexanedial?
The IUPAC name of (3S)-3-methylhexanedial (CID 129384452) is (3S)-3-methylhexanedial.
What is the SMILES notation for (3S)-3-methylhexanedial?
The canonical SMILES for (3S)-3-methylhexanedial is C[C@H](CC=O)CCC=O.
What is the InChIKey of (3S)-3-methylhexanedial?
The InChIKey is REOYKRDMVBXLRN-ZETCQYMHSA-N. The full InChI is InChI=1S/C7H12O2/c1-7(4-6-9)3-2-5-8/h5-7H,2-4H2,1H3/t7-/m0/s1.
What are the key properties of (3S)-3-methylhexanedial?
(3S)-3-methylhexanedial has a molecular weight of 128.17 g/mol, XLogP of 1.19, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-methylhexanedial is sourced from PubChem (CID 129384452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).