About 2-hydroxypentanedial;3-methylpentanedial
2-hydroxypentanedial;3-methylpentanedial (PubChem CID 118362127) has the molecular formula C11H18O5
and a molecular weight of 230.26 g/mol. Its IUPAC name is 2-hydroxypentanedial;3-methylpentanedial.
Molecular Properties
| Compound Name | 2-hydroxypentanedial;3-methylpentanedial |
| PubChem CID | 118362127 |
| Molecular Formula | C11H18O5 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 2-hydroxypentanedial;3-methylpentanedial |
| SMILES | CC(CC=O)CC=O.O=CCCC(O)C=O |
| InChI | InChI=1S/C6H10O2.C5H8O3/c1-6(2-4-7)3-5-8;6-3-1-2-5(8)4-7/h4-6H,2-3H2,1H3;3-5,8H,1-2H2 |
| InChIKey | JIBATVRMFVIVCO-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxypentanedial;3-methylpentanedial with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxypentanedial;3-methylpentanedial?
The IUPAC name of 2-hydroxypentanedial;3-methylpentanedial (CID 118362127) is 2-hydroxypentanedial;3-methylpentanedial.
What is the SMILES notation for 2-hydroxypentanedial;3-methylpentanedial?
The canonical SMILES for 2-hydroxypentanedial;3-methylpentanedial is CC(CC=O)CC=O.O=CCCC(O)C=O.
What is the InChIKey of 2-hydroxypentanedial;3-methylpentanedial?
The InChIKey is JIBATVRMFVIVCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O2.C5H8O3/c1-6(2-4-7)3-5-8;6-3-1-2-5(8)4-7/h4-6H,2-3H2,1H3;3-5,8H,1-2H2.
What are the key properties of 2-hydroxypentanedial;3-methylpentanedial?
2-hydroxypentanedial;3-methylpentanedial has a molecular weight of 230.26 g/mol, XLogP of 0.33, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxypentanedial;3-methylpentanedial is sourced from PubChem (CID 118362127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).