About 4,6-dimethylheptanal
4,6-dimethylheptanal (PubChem CID 57105228) has the molecular formula C9H18O
and a molecular weight of 142.24 g/mol. Its IUPAC name is 4,6-dimethylheptanal.
Molecular Properties
| Compound Name | 4,6-dimethylheptanal |
| PubChem CID | 57105228 |
| Molecular Formula | C9H18O |
| Molecular Weight | 142.24 g/mol |
| Exact Mass | 142.14 |
| IUPAC Name | 4,6-dimethylheptanal |
| SMILES | CC(C)CC(C)CCC=O |
| InChI | InChI=1S/C9H18O/c1-8(2)7-9(3)5-4-6-10/h6,8-9H,4-5,7H2,1-3H3 |
| InChIKey | OIZYWYZAFCQLOI-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.24 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4,6-dimethylheptanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dimethylheptanal?
The IUPAC name of 4,6-dimethylheptanal (CID 57105228) is 4,6-dimethylheptanal.
What is the SMILES notation for 4,6-dimethylheptanal?
The canonical SMILES for 4,6-dimethylheptanal is CC(C)CC(C)CCC=O.
What is the InChIKey of 4,6-dimethylheptanal?
The InChIKey is OIZYWYZAFCQLOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O/c1-8(2)7-9(3)5-4-6-10/h6,8-9H,4-5,7H2,1-3H3.
What are the key properties of 4,6-dimethylheptanal?
4,6-dimethylheptanal has a molecular weight of 142.24 g/mol, XLogP of 2.65, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dimethylheptanal is sourced from PubChem (CID 57105228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).