C13H26O — CID 135207816
5,7,9-trimethyldecanal (PubChem CID 135207816) has the molecular formula C13H26O and a molecular weight of 198.35 g/mol. Its IUPAC name is 5,7,9-trimethyldecanal.
| Compound Name | 5,7,9-trimethyldecanal |
|---|---|
| PubChem CID | 135207816 |
| Molecular Formula | C13H26O |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.20 |
| IUPAC Name | 5,7,9-trimethyldecanal |
| SMILES | CC(C)CC(C)CC(C)CCCC=O |
| InChI | InChI=1S/C13H26O/c1-11(2)9-13(4)10-12(3)7-5-6-8-14/h8,11-13H,5-7,9-10H2,1-4H3 |
| InChIKey | UIXNYKYPYXZHFB-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|