C10H20O — CID 170849644
(2R,4S)-2,4,6-trimethylheptanal (PubChem CID 170849644) has the molecular formula C10H20O and a molecular weight of 156.27 g/mol. Its IUPAC name is (2R,4S)-2,4,6-trimethylheptanal.
| Compound Name | (2R,4S)-2,4,6-trimethylheptanal |
|---|---|
| PubChem CID | 170849644 |
| Molecular Formula | C10H20O |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.15 |
| IUPAC Name | (2R,4S)-2,4,6-trimethylheptanal |
| SMILES | CC(C)C[C@H](C)C[C@@H](C)C=O |
| InChI | InChI=1S/C10H20O/c1-8(2)5-9(3)6-10(4)7-11/h7-10H,5-6H2,1-4H3/t9-,10+/m0/s1 |
| InChIKey | QSDCTHKAKGHTCN-VHSXEESVSA-N |
| XLogP | 2.89 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|