C15H30O — CID 10900342
(2R,4R,6R,8R)-2,4,6,8-tetramethylundecanal (PubChem CID 10900342) has the molecular formula C15H30O and a molecular weight of 226.40 g/mol. Its IUPAC name is (2R,4R,6R,8R)-2,4,6,8-tetramethylundecanal.
| Compound Name | (2R,4R,6R,8R)-2,4,6,8-tetramethylundecanal |
|---|---|
| PubChem CID | 10900342 |
| Molecular Formula | C15H30O |
| Molecular Weight | 226.40 g/mol |
| Exact Mass | 226.23 |
| IUPAC Name | (2R,4R,6R,8R)-2,4,6,8-tetramethylundecanal |
| SMILES | CCC[C@@H](C)C[C@@H](C)C[C@@H](C)C[C@@H](C)C=O |
| InChI | InChI=1S/C15H30O/c1-6-7-12(2)8-13(3)9-14(4)10-15(5)11-16/h11-15H,6-10H2,1-5H3/t12-,13-,14-,15-/m1/s1 |
| InChIKey | QMSOTLXFJWXUCT-KBUPBQIOSA-N |
| XLogP | 4.70 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.40 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|