C17H34O — CID 101374149
(E,3R,6R,8R,10R)-4,6,8,10-tetramethyltridec-4-en-3-ol (PubChem CID 101374149) has the molecular formula C17H34O and a molecular weight of 254.46 g/mol. Its IUPAC name is (E,3R,6R,8R,10R)-4,6,8,10-tetramethyltridec-4-en-3-ol.
| Compound Name | (E,3R,6R,8R,10R)-4,6,8,10-tetramethyltridec-4-en-3-ol |
|---|---|
| PubChem CID | 101374149 |
| Molecular Formula | C17H34O |
| Molecular Weight | 254.46 g/mol |
| Exact Mass | 254.26 |
| IUPAC Name | (E,3R,6R,8R,10R)-4,6,8,10-tetramethyltridec-4-en-3-ol |
| SMILES | CCC[C@@H](C)C[C@@H](C)C[C@@H](C)/C=C(\C)[C@H](O)CC |
| InChI | InChI=1S/C17H34O/c1-7-9-13(3)10-14(4)11-15(5)12-16(6)17(18)8-2/h12-15,17-18H,7-11H2,1-6H3/b16-12+/t13-,14-,15-,17-/m1/s1 |
| InChIKey | LNSIAKDKGRHKLN-OCBPEPKVSA-N |
| XLogP | 5.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.46 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|