About potassium;hydride;2-methylpentanal
potassium;hydride;2-methylpentanal (PubChem CID 173401246) has the molecular formula C6H13KO
and a molecular weight of 140.27 g/mol. Its IUPAC name is potassium;hydride;2-methylpentanal.
Molecular Properties
| Compound Name | potassium;hydride;2-methylpentanal |
| PubChem CID | 173401246 |
| Molecular Formula | C6H13KO |
| Molecular Weight | 140.27 g/mol |
| Exact Mass | 140.06 |
| IUPAC Name | potassium;hydride;2-methylpentanal |
| SMILES | CCCC(C)C=O.[H-].[K+] |
| InChI | InChI=1S/C6H12O.K.H/c1-3-4-6(2)5-7;;/h5-6H,3-4H2,1-2H3;;/q;+1;-1 |
| InChIKey | RLYDKPAQFZVDBE-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.27 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze potassium;hydride;2-methylpentanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;hydride;2-methylpentanal?
The IUPAC name of potassium;hydride;2-methylpentanal (CID 173401246) is potassium;hydride;2-methylpentanal.
What is the SMILES notation for potassium;hydride;2-methylpentanal?
The canonical SMILES for potassium;hydride;2-methylpentanal is CCCC(C)C=O.[H-].[K+].
What is the InChIKey of potassium;hydride;2-methylpentanal?
The InChIKey is RLYDKPAQFZVDBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O.K.H/c1-3-4-6(2)5-7;;/h5-6H,3-4H2,1-2H3;;/q;+1;-1.
What are the key properties of potassium;hydride;2-methylpentanal?
potassium;hydride;2-methylpentanal has a molecular weight of 140.27 g/mol, XLogP of -1.26, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;hydride;2-methylpentanal is sourced from PubChem (CID 173401246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).