C11H25NO — CID 153346269
N,2-dimethylpropan-2-amine;2-methylpentanal (PubChem CID 153346269) has the molecular formula C11H25NO and a molecular weight of 187.33 g/mol. Its IUPAC name is N,2-dimethylpropan-2-amine;2-methylpentanal.
| Compound Name | N,2-dimethylpropan-2-amine;2-methylpentanal |
|---|---|
| PubChem CID | 153346269 |
| Molecular Formula | C11H25NO |
| Molecular Weight | 187.33 g/mol |
| Exact Mass | 187.19 |
| IUPAC Name | N,2-dimethylpropan-2-amine;2-methylpentanal |
| SMILES | CCCC(C)C=O.CNC(C)(C)C |
| InChI | InChI=1S/C6H12O.C5H13N/c1-3-4-6(2)5-7;1-5(2,3)6-4/h5-6H,3-4H2,1-2H3;6H,1-4H3 |
| InChIKey | VYIISDWSBOKABF-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.33 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|