About N,2-dimethylpropan-2-amine;2-methylpentanal
N,2-dimethylpropan-2-amine;2-methylpentanal (PubChem CID 153346269) has the molecular formula C11H25NO
and a molecular weight of 187.33 g/mol. Its IUPAC name is N,2-dimethylpropan-2-amine;2-methylpentanal.
Molecular Properties
| Compound Name | N,2-dimethylpropan-2-amine;2-methylpentanal |
| PubChem CID | 153346269 |
| Molecular Formula | C11H25NO |
| Molecular Weight | 187.33 g/mol |
| Exact Mass | 187.19 |
| IUPAC Name | N,2-dimethylpropan-2-amine;2-methylpentanal |
| SMILES | CCCC(C)C=O.CNC(C)(C)C |
| InChI | InChI=1S/C6H12O.C5H13N/c1-3-4-6(2)5-7;1-5(2,3)6-4/h5-6H,3-4H2,1-2H3;6H,1-4H3 |
| InChIKey | VYIISDWSBOKABF-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.33 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N,2-dimethylpropan-2-amine;2-methylpentanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,2-dimethylpropan-2-amine;2-methylpentanal?
The IUPAC name of N,2-dimethylpropan-2-amine;2-methylpentanal (CID 153346269) is N,2-dimethylpropan-2-amine;2-methylpentanal.
What is the SMILES notation for N,2-dimethylpropan-2-amine;2-methylpentanal?
The canonical SMILES for N,2-dimethylpropan-2-amine;2-methylpentanal is CCCC(C)C=O.CNC(C)(C)C.
What is the InChIKey of N,2-dimethylpropan-2-amine;2-methylpentanal?
The InChIKey is VYIISDWSBOKABF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O.C5H13N/c1-3-4-6(2)5-7;1-5(2,3)6-4/h5-6H,3-4H2,1-2H3;6H,1-4H3.
What are the key properties of N,2-dimethylpropan-2-amine;2-methylpentanal?
N,2-dimethylpropan-2-amine;2-methylpentanal has a molecular weight of 187.33 g/mol, XLogP of 2.63, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,2-dimethylpropan-2-amine;2-methylpentanal is sourced from PubChem (CID 153346269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).