C11H22O2 — CID 89205159
(2S)-5-butoxy-2,4-dimethylpentanal (PubChem CID 89205159) has the molecular formula C11H22O2 and a molecular weight of 186.29 g/mol. Its IUPAC name is (2S)-5-butoxy-2,4-dimethylpentanal.
| Compound Name | (2S)-5-butoxy-2,4-dimethylpentanal |
|---|---|
| PubChem CID | 89205159 |
| Molecular Formula | C11H22O2 |
| Molecular Weight | 186.29 g/mol |
| Exact Mass | 186.16 |
| IUPAC Name | (2S)-5-butoxy-2,4-dimethylpentanal |
| SMILES | CCCCOCC(C)C[C@H](C)C=O |
| InChI | InChI=1S/C11H22O2/c1-4-5-6-13-9-11(3)7-10(2)8-12/h8,10-11H,4-7,9H2,1-3H3/t10-,11?/m0/s1 |
| InChIKey | FWXYLUIDIOSGIG-VUWPPUDQSA-N |
| XLogP | 2.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.29 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|