C13H30N2O — CID 118465726
(3R)-4-hexoxy-1-N,1-N',3-trimethylbutane-1,1-diamine (PubChem CID 118465726) has the molecular formula C13H30N2O and a molecular weight of 230.40 g/mol. Its IUPAC name is (3R)-4-hexoxy-1-N,1-N',3-trimethylbutane-1,1-diamine.
| Compound Name | (3R)-4-hexoxy-1-N,1-N',3-trimethylbutane-1,1-diamine |
|---|---|
| PubChem CID | 118465726 |
| Molecular Formula | C13H30N2O |
| Molecular Weight | 230.40 g/mol |
| Exact Mass | 230.24 |
| IUPAC Name | (3R)-4-hexoxy-1-N,1-N',3-trimethylbutane-1,1-diamine |
| SMILES | CCCCCCOC[C@H](C)CC(NC)NC |
| InChI | InChI=1S/C13H30N2O/c1-5-6-7-8-9-16-11-12(2)10-13(14-3)15-4/h12-15H,5-11H2,1-4H3/t12-/m1/s1 |
| InChIKey | GBLNRNXIHYLQHL-GFCCVEGCSA-N |
| XLogP | 2.37 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.40 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|