C15H27Br — CID 154093071
1-bromo-3,7,11-trimethyldodeca-2,4-diene (PubChem CID 154093071) has the molecular formula C15H27Br and a molecular weight of 287.29 g/mol. Its IUPAC name is 1-bromo-3,7,11-trimethyldodeca-2,4-diene.
| Compound Name | 1-bromo-3,7,11-trimethyldodeca-2,4-diene |
|---|---|
| PubChem CID | 154093071 |
| Molecular Formula | C15H27Br |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 1-bromo-3,7,11-trimethyldodeca-2,4-diene |
| SMILES | CC(C=CCC(C)CCCC(C)C)=CCBr |
| InChI | InChI=1S/C15H27Br/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-16/h6,10-11,13-14H,5,7-9,12H2,1-4H3 |
| InChIKey | XOBULJUBVDAICU-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|