C40H64 — CID 85447618
2,6,10,14,19,23,27,31-octamethyldotriaconta-8,10,12,14,16,18,20,22,24-nonaene (PubChem CID 85447618) has the molecular formula C40H64 and a molecular weight of 544.95 g/mol. Its IUPAC name is 2,6,10,14,19,23,27,31-octamethyldotriaconta-8,10,12,14,16,18,20,22,24-nonaene.
| Compound Name | 2,6,10,14,19,23,27,31-octamethyldotriaconta-8,10,12,14,16,18,20,22,24-nonaene |
|---|---|
| PubChem CID | 85447618 |
| Molecular Formula | C40H64 |
| Molecular Weight | 544.95 g/mol |
| Exact Mass | 544.50 |
| IUPAC Name | 2,6,10,14,19,23,27,31-octamethyldotriaconta-8,10,12,14,16,18,20,22,24-nonaene |
| SMILES | CC(C=CC=C(C)C=CCC(C)CCCC(C)C)=CC=CC=C(C)C=CC=C(C)C=CCC(C)CCCC(C)C |
| InChI | InChI=1S/C40H64/c1-33(2)19-13-23-37(7)27-17-31-39(9)29-15-25-35(5)21-11-12-22-36(6)26-16-30-40(10)32-18-28-38(8)24-14-20-34(3)4/h11-12,15-18,21-22,25-26,29-34,37-38H,13-14,19-20,23-24,27-28H2,1-10H3 |
| InChIKey | OKDGMNDOILHHFK-UHFFFAOYSA-N |
| XLogP | 13.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.95 |
| LogP ≤ 5 | 13.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|