C22H44O2Si — CID 101242202
trimethylsilyl (E)-2,6,10,14-tetramethylpentadec-2-enoate (PubChem CID 101242202) has the molecular formula C22H44O2Si and a molecular weight of 368.68 g/mol. Its IUPAC name is trimethylsilyl (E)-2,6,10,14-tetramethylpentadec-2-enoate.
| Compound Name | trimethylsilyl (E)-2,6,10,14-tetramethylpentadec-2-enoate |
|---|---|
| PubChem CID | 101242202 |
| Molecular Formula | C22H44O2Si |
| Molecular Weight | 368.68 g/mol |
| Exact Mass | 368.31 |
| IUPAC Name | trimethylsilyl (E)-2,6,10,14-tetramethylpentadec-2-enoate |
| SMILES | C/C(=C\CCC(C)CCCC(C)CCCC(C)C)C(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C22H44O2Si/c1-18(2)12-9-13-19(3)14-10-15-20(4)16-11-17-21(5)22(23)24-25(6,7)8/h17-20H,9-16H2,1-8H3/b21-17+ |
| InChIKey | ABCAAWJJMFNRNE-HEHNFIMWSA-N |
| XLogP | 7.36 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.68 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|