C17H30O2 — CID 54403356
ethyl 3,4,7,10-tetramethylundeca-2,4-dienoate (PubChem CID 54403356) has the molecular formula C17H30O2 and a molecular weight of 266.42 g/mol. Its IUPAC name is ethyl 3,4,7,10-tetramethylundeca-2,4-dienoate.
| Compound Name | ethyl 3,4,7,10-tetramethylundeca-2,4-dienoate |
|---|---|
| PubChem CID | 54403356 |
| Molecular Formula | C17H30O2 |
| Molecular Weight | 266.42 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | ethyl 3,4,7,10-tetramethylundeca-2,4-dienoate |
| SMILES | CCOC(=O)C=C(C)C(C)=CCC(C)CCC(C)C |
| InChI | InChI=1S/C17H30O2/c1-7-19-17(18)12-16(6)15(5)11-10-14(4)9-8-13(2)3/h11-14H,7-10H2,1-6H3 |
| InChIKey | VOZNLTXIMSZUEE-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.42 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|