C17H29FO2 — CID 92533833
ethyl (2E,4S,7S)-4-fluoro-3,7,11-trimethyldodeca-2,10-dienoate (PubChem CID 92533833) has the molecular formula C17H29FO2 and a molecular weight of 284.42 g/mol. Its IUPAC name is ethyl (2E,4S,7S)-4-fluoro-3,7,11-trimethyldodeca-2,10-dienoate.
| Compound Name | ethyl (2E,4S,7S)-4-fluoro-3,7,11-trimethyldodeca-2,10-dienoate |
|---|---|
| PubChem CID | 92533833 |
| Molecular Formula | C17H29FO2 |
| Molecular Weight | 284.42 g/mol |
| Exact Mass | 284.22 |
| IUPAC Name | ethyl (2E,4S,7S)-4-fluoro-3,7,11-trimethyldodeca-2,10-dienoate |
| SMILES | CCOC(=O)/C=C(\C)[C@@H](F)CC[C@@H](C)CCC=C(C)C |
| InChI | InChI=1S/C17H29FO2/c1-6-20-17(19)12-15(5)16(18)11-10-14(4)9-7-8-13(2)3/h8,12,14,16H,6-7,9-11H2,1-5H3/b15-12+/t14-,16-/m0/s1 |
| InChIKey | OTKIGOQOBINIIB-NEWSFODOSA-N |
| XLogP | 5.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.42 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|