C22H22O6 — CID 164679144
1-O,1-O-dibenzyl 4-O-methyl (E)-but-3-ene-1,1,4-tricarboxylate (PubChem CID 164679144) has the molecular formula C22H22O6 and a molecular weight of 382.41 g/mol. Its IUPAC name is 1-O,1-O-dibenzyl 4-O-methyl (E)-but-3-ene-1,1,4-tricarboxylate.
| Compound Name | 1-O,1-O-dibenzyl 4-O-methyl (E)-but-3-ene-1,1,4-tricarboxylate |
|---|---|
| PubChem CID | 164679144 |
| Molecular Formula | C22H22O6 |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 1-O,1-O-dibenzyl 4-O-methyl (E)-but-3-ene-1,1,4-tricarboxylate |
| SMILES | COC(=O)/C=C/CC(C(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H22O6/c1-26-20(23)14-8-13-19(21(24)27-15-17-9-4-2-5-10-17)22(25)28-16-18-11-6-3-7-12-18/h2-12,14,19H,13,15-16H2,1H3/b14-8+ |
| InChIKey | RQJUMRWAZTWJJA-RIYZIHGNSA-N |
| XLogP | 3.21 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|