C16H21NO5 — CID 123635926
methyl (5R)-5-(2-nitrosoethoxy)-6-phenylmethoxyhex-2-enoate (PubChem CID 123635926) has the molecular formula C16H21NO5 and a molecular weight of 307.35 g/mol. Its IUPAC name is methyl (5R)-5-(2-nitrosoethoxy)-6-phenylmethoxyhex-2-enoate.
| Compound Name | methyl (5R)-5-(2-nitrosoethoxy)-6-phenylmethoxyhex-2-enoate |
|---|---|
| PubChem CID | 123635926 |
| Molecular Formula | C16H21NO5 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | methyl (5R)-5-(2-nitrosoethoxy)-6-phenylmethoxyhex-2-enoate |
| SMILES | COC(=O)C=CC[C@H](COCc1ccccc1)OCCN=O |
| InChI | InChI=1S/C16H21NO5/c1-20-16(18)9-5-8-15(22-11-10-17-19)13-21-12-14-6-3-2-4-7-14/h2-7,9,15H,8,10-13H2,1H3/t15-/m1/s1 |
| InChIKey | SPBLGTSQOAYOSW-OAHLLOKOSA-N |
| XLogP | 2.47 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|