C21H34O5Si — CID 10894529
methyl (E)-3-[(2R)-4-[tert-butyl(dimethyl)silyl]oxy-1-phenylmethoxybutan-2-yl]oxyprop-2-enoate (PubChem CID 10894529) has the molecular formula C21H34O5Si and a molecular weight of 394.58 g/mol. Its IUPAC name is methyl (E)-3-[(2R)-4-[tert-butyl(dimethyl)silyl]oxy-1-phenylmethoxybutan-2-yl]oxyprop-2-enoate.
| Compound Name | methyl (E)-3-[(2R)-4-[tert-butyl(dimethyl)silyl]oxy-1-phenylmethoxybutan-2-yl]oxyprop-2-enoate |
|---|---|
| PubChem CID | 10894529 |
| Molecular Formula | C21H34O5Si |
| Molecular Weight | 394.58 g/mol |
| Exact Mass | 394.22 |
| IUPAC Name | methyl (E)-3-[(2R)-4-[tert-butyl(dimethyl)silyl]oxy-1-phenylmethoxybutan-2-yl]oxyprop-2-enoate |
| SMILES | COC(=O)/C=C/O[C@H](CCO[Si](C)(C)C(C)(C)C)COCc1ccccc1 |
| InChI | InChI=1S/C21H34O5Si/c1-21(2,3)27(5,6)26-15-12-19(25-14-13-20(22)23-4)17-24-16-18-10-8-7-9-11-18/h7-11,13-14,19H,12,15-17H2,1-6H3/b14-13+/t19-/m1/s1 |
| InChIKey | USYWMALKDPPUEE-JKIKYLSZSA-N |
| XLogP | 4.69 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.58 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|