C23H38O3Si — CID 10938011
(E)-2-[4-[tert-butyl(dimethyl)silyl]oxy-1-phenylmethoxybutan-2-yl]hex-2-enal (PubChem CID 10938011) has the molecular formula C23H38O3Si and a molecular weight of 390.64 g/mol. Its IUPAC name is (E)-2-[4-[tert-butyl(dimethyl)silyl]oxy-1-phenylmethoxybutan-2-yl]hex-2-enal.
| Compound Name | (E)-2-[4-[tert-butyl(dimethyl)silyl]oxy-1-phenylmethoxybutan-2-yl]hex-2-enal |
|---|---|
| PubChem CID | 10938011 |
| Molecular Formula | C23H38O3Si |
| Molecular Weight | 390.64 g/mol |
| Exact Mass | 390.26 |
| IUPAC Name | (E)-2-[4-[tert-butyl(dimethyl)silyl]oxy-1-phenylmethoxybutan-2-yl]hex-2-enal |
| SMILES | CCC/C=C(/C=O)C(CCO[Si](C)(C)C(C)(C)C)COCc1ccccc1 |
| InChI | InChI=1S/C23H38O3Si/c1-7-8-14-21(17-24)22(15-16-26-27(5,6)23(2,3)4)19-25-18-20-12-10-9-11-13-20/h9-14,17,22H,7-8,15-16,18-19H2,1-6H3/b21-14- |
| InChIKey | BJKGCWFFAVEOSL-STZFKDTASA-N |
| XLogP | 6.16 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.64 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|