C41H51NO3Si — CID 10651671
(E,2S)-9-[tert-butyl(dimethyl)silyl]oxy-1-phenylmethoxy-2-(tritylamino)non-4-en-3-one (PubChem CID 10651671) has the molecular formula C41H51NO3Si and a molecular weight of 633.95 g/mol. Its IUPAC name is (E,2S)-9-[tert-butyl(dimethyl)silyl]oxy-1-phenylmethoxy-2-(tritylamino)non-4-en-3-one.
| Compound Name | (E,2S)-9-[tert-butyl(dimethyl)silyl]oxy-1-phenylmethoxy-2-(tritylamino)non-4-en-3-one |
|---|---|
| PubChem CID | 10651671 |
| Molecular Formula | C41H51NO3Si |
| Molecular Weight | 633.95 g/mol |
| Exact Mass | 633.36 |
| IUPAC Name | (E,2S)-9-[tert-butyl(dimethyl)silyl]oxy-1-phenylmethoxy-2-(tritylamino)non-4-en-3-one |
| SMILES | CC(C)(C)[Si](C)(C)OCCCC/C=C/C(=O)[C@H](COCc1ccccc1)NC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C41H51NO3Si/c1-40(2,3)46(4,5)45-31-21-7-6-20-30-39(43)38(33-44-32-34-22-12-8-13-23-34)42-41(35-24-14-9-15-25-35,36-26-16-10-17-27-36)37-28-18-11-19-29-37/h8-20,22-30,38,42H,6-7,21,31-33H2,1-5H3/b30-20+/t38-/m0/s1 |
| InChIKey | ZEXRQAHTVCUZJP-LLBAPVFPSA-N |
| XLogP | 9.47 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.95 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|