C41H41NO3 — CID 10841223
(E,2S)-8-(4-methoxyphenyl)-1-phenylmethoxy-2-(tritylamino)oct-4-en-3-one (PubChem CID 10841223) has the molecular formula C41H41NO3 and a molecular weight of 595.78 g/mol. Its IUPAC name is (E,2S)-8-(4-methoxyphenyl)-1-phenylmethoxy-2-(tritylamino)oct-4-en-3-one.
| Compound Name | (E,2S)-8-(4-methoxyphenyl)-1-phenylmethoxy-2-(tritylamino)oct-4-en-3-one |
|---|---|
| PubChem CID | 10841223 |
| Molecular Formula | C41H41NO3 |
| Molecular Weight | 595.78 g/mol |
| Exact Mass | 595.31 |
| IUPAC Name | (E,2S)-8-(4-methoxyphenyl)-1-phenylmethoxy-2-(tritylamino)oct-4-en-3-one |
| SMILES | COc1ccc(CCC/C=C/C(=O)[C@H](COCc2ccccc2)NC(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C41H41NO3/c1-44-38-29-27-33(28-30-38)17-7-3-16-26-40(43)39(32-45-31-34-18-8-2-9-19-34)42-41(35-20-10-4-11-21-35,36-22-12-5-13-23-36)37-24-14-6-15-25-37/h2,4-6,8-16,18-30,39,42H,3,7,17,31-32H2,1H3/b26-16+/t39-/m0/s1 |
| InChIKey | LLZNYDCXSCOFFB-MJVMJATDSA-N |
| XLogP | 8.31 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.78 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|