C35H35NO6 — CID 88738122
N-[1-[3,4-bis(phenylmethoxy)phenyl]-7-(4-methoxyphenyl)-1,4-dioxoheptan-2-yl]formamide (PubChem CID 88738122) has the molecular formula C35H35NO6 and a molecular weight of 565.67 g/mol. Its IUPAC name is N-[1-[3,4-bis(phenylmethoxy)phenyl]-7-(4-methoxyphenyl)-1,4-dioxoheptan-2-yl]formamide.
| Compound Name | N-[1-[3,4-bis(phenylmethoxy)phenyl]-7-(4-methoxyphenyl)-1,4-dioxoheptan-2-yl]formamide |
|---|---|
| PubChem CID | 88738122 |
| Molecular Formula | C35H35NO6 |
| Molecular Weight | 565.67 g/mol |
| Exact Mass | 565.25 |
| IUPAC Name | N-[1-[3,4-bis(phenylmethoxy)phenyl]-7-(4-methoxyphenyl)-1,4-dioxoheptan-2-yl]formamide |
| SMILES | COc1ccc(CCCC(=O)CC(NC=O)C(=O)c2ccc(OCc3ccccc3)c(OCc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C35H35NO6/c1-40-31-18-15-26(16-19-31)13-8-14-30(38)22-32(36-25-37)35(39)29-17-20-33(41-23-27-9-4-2-5-10-27)34(21-29)42-24-28-11-6-3-7-12-28/h2-7,9-12,15-21,25,32H,8,13-14,22-24H2,1H3,(H,36,37) |
| InChIKey | HLJVJFKSDGUWJU-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.67 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|