C40H49NO4Si — CID 10817856
methyl (Z,2S,5S)-2-(2-methylpropyl)-6-phenylmethoxy-4-trimethylsilyloxy-5-(tritylamino)hex-3-enoate (PubChem CID 10817856) has the molecular formula C40H49NO4Si and a molecular weight of 635.92 g/mol. Its IUPAC name is methyl (Z,2S,5S)-2-(2-methylpropyl)-6-phenylmethoxy-4-trimethylsilyloxy-5-(tritylamino)hex-3-enoate.
| Compound Name | methyl (Z,2S,5S)-2-(2-methylpropyl)-6-phenylmethoxy-4-trimethylsilyloxy-5-(tritylamino)hex-3-enoate |
|---|---|
| PubChem CID | 10817856 |
| Molecular Formula | C40H49NO4Si |
| Molecular Weight | 635.92 g/mol |
| Exact Mass | 635.34 |
| IUPAC Name | methyl (Z,2S,5S)-2-(2-methylpropyl)-6-phenylmethoxy-4-trimethylsilyloxy-5-(tritylamino)hex-3-enoate |
| SMILES | COC(=O)[C@H](/C=C(\O[Si](C)(C)C)[C@H](COCc1ccccc1)NC(c1ccccc1)(c1ccccc1)c1ccccc1)CC(C)C |
| InChI | InChI=1S/C40H49NO4Si/c1-31(2)27-33(39(42)43-3)28-38(45-46(4,5)6)37(30-44-29-32-19-11-7-12-20-32)41-40(34-21-13-8-14-22-34,35-23-15-9-16-24-35)36-25-17-10-18-26-36/h7-26,28,31,33,37,41H,27,29-30H2,1-6H3/b38-28-/t33-,37-/m0/s1 |
| InChIKey | ZWECRTULBXSBSE-VFGJAVEZSA-N |
| XLogP | 8.72 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.92 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|