C58H54N2O2 — CID 71714200
(E,2S,5S)-1,6-bis(phenylmethoxy)-2-N,5-N-ditritylhex-3-ene-2,5-diamine (PubChem CID 71714200) has the molecular formula C58H54N2O2 and a molecular weight of 811.08 g/mol. Its IUPAC name is (E,2S,5S)-1,6-bis(phenylmethoxy)-2-N,5-N-ditritylhex-3-ene-2,5-diamine.
| Compound Name | (E,2S,5S)-1,6-bis(phenylmethoxy)-2-N,5-N-ditritylhex-3-ene-2,5-diamine |
|---|---|
| PubChem CID | 71714200 |
| Molecular Formula | C58H54N2O2 |
| Molecular Weight | 811.08 g/mol |
| Exact Mass | 810.42 |
| IUPAC Name | (E,2S,5S)-1,6-bis(phenylmethoxy)-2-N,5-N-ditritylhex-3-ene-2,5-diamine |
| SMILES | C(=C/[C@@H](COCc1ccccc1)NC(c1ccccc1)(c1ccccc1)c1ccccc1)\[C@@H](COCc1ccccc1)NC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C58H54N2O2/c1-9-25-47(26-10-1)43-61-45-55(59-57(49-29-13-3-14-30-49,50-31-15-4-16-32-50)51-33-17-5-18-34-51)41-42-56(46-62-44-48-27-11-2-12-28-48)60-58(52-35-19-6-20-36-52,53-37-21-7-22-38-53)54-39-23-8-24-40-54/h1-42,55-56,59-60H,43-46H2/b42-41+/t55-,56-/m0/s1 |
| InChIKey | GXMOLDGKSIYCBH-CHJZFIFZSA-N |
| XLogP | 11.88 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.08 |
| LogP ≤ 5 | 11.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|