C32H33NO5 — CID 67998750
methyl (2S)-3-[[2-(methoxymethoxy)phenyl]methoxy]-2-(tritylamino)propanoate (PubChem CID 67998750) has the molecular formula C32H33NO5 and a molecular weight of 511.62 g/mol. Its IUPAC name is methyl (2S)-3-[[2-(methoxymethoxy)phenyl]methoxy]-2-(tritylamino)propanoate.
| Compound Name | methyl (2S)-3-[[2-(methoxymethoxy)phenyl]methoxy]-2-(tritylamino)propanoate |
|---|---|
| PubChem CID | 67998750 |
| Molecular Formula | C32H33NO5 |
| Molecular Weight | 511.62 g/mol |
| Exact Mass | 511.24 |
| IUPAC Name | methyl (2S)-3-[[2-(methoxymethoxy)phenyl]methoxy]-2-(tritylamino)propanoate |
| SMILES | COCOc1ccccc1COC[C@H](NC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)OC |
| InChI | InChI=1S/C32H33NO5/c1-35-24-38-30-21-13-12-14-25(30)22-37-23-29(31(34)36-2)33-32(26-15-6-3-7-16-26,27-17-8-4-9-18-27)28-19-10-5-11-20-28/h3-21,29,33H,22-24H2,1-2H3/t29-/m0/s1 |
| InChIKey | SBFZLXSOAPEFDW-LJAQVGFWSA-N |
| XLogP | 5.31 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.62 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|