C31H39NO3 — CID 10863686
methyl (2S)-3-octoxy-2-(tritylamino)propanoate (PubChem CID 10863686) has the molecular formula C31H39NO3 and a molecular weight of 473.66 g/mol. Its IUPAC name is methyl (2S)-3-octoxy-2-(tritylamino)propanoate.
| Compound Name | methyl (2S)-3-octoxy-2-(tritylamino)propanoate |
|---|---|
| PubChem CID | 10863686 |
| Molecular Formula | C31H39NO3 |
| Molecular Weight | 473.66 g/mol |
| Exact Mass | 473.29 |
| IUPAC Name | methyl (2S)-3-octoxy-2-(tritylamino)propanoate |
| SMILES | CCCCCCCCOC[C@H](NC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)OC |
| InChI | InChI=1S/C31H39NO3/c1-3-4-5-6-7-17-24-35-25-29(30(33)34-2)32-31(26-18-11-8-12-19-26,27-20-13-9-14-21-27)28-22-15-10-16-23-28/h8-16,18-23,29,32H,3-7,17,24-25H2,1-2H3/t29-/m0/s1 |
| InChIKey | HQMMZOIVBQRCDU-LJAQVGFWSA-N |
| XLogP | 6.49 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.66 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|