C29H26FNO3 — CID 118862708
methyl 3-(3-fluorophenoxy)-2-(tritylamino)propanoate (PubChem CID 118862708) has the molecular formula C29H26FNO3 and a molecular weight of 455.53 g/mol. Its IUPAC name is methyl 3-(3-fluorophenoxy)-2-(tritylamino)propanoate.
| Compound Name | methyl 3-(3-fluorophenoxy)-2-(tritylamino)propanoate |
|---|---|
| PubChem CID | 118862708 |
| Molecular Formula | C29H26FNO3 |
| Molecular Weight | 455.53 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | methyl 3-(3-fluorophenoxy)-2-(tritylamino)propanoate |
| SMILES | COC(=O)C(COc1cccc(F)c1)NC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H26FNO3/c1-33-28(32)27(21-34-26-19-11-18-25(30)20-26)31-29(22-12-5-2-6-13-22,23-14-7-3-8-15-23)24-16-9-4-10-17-24/h2-20,27,31H,21H2,1H3 |
| InChIKey | HVNZEDMVNSBTNB-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.53 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|