C30H24F2N2O7 — CID 166124418
methyl (2S)-3-[(2,2-difluoro-6-nitro-1,3-benzodioxol-5-yl)oxy]-2-(tritylamino)propanoate (PubChem CID 166124418) has the molecular formula C30H24F2N2O7 and a molecular weight of 562.53 g/mol. Its IUPAC name is methyl (2S)-3-[(2,2-difluoro-6-nitro-1,3-benzodioxol-5-yl)oxy]-2-(tritylamino)propanoate.
| Compound Name | methyl (2S)-3-[(2,2-difluoro-6-nitro-1,3-benzodioxol-5-yl)oxy]-2-(tritylamino)propanoate |
|---|---|
| PubChem CID | 166124418 |
| Molecular Formula | C30H24F2N2O7 |
| Molecular Weight | 562.53 g/mol |
| Exact Mass | 562.16 |
| IUPAC Name | methyl (2S)-3-[(2,2-difluoro-6-nitro-1,3-benzodioxol-5-yl)oxy]-2-(tritylamino)propanoate |
| SMILES | COC(=O)[C@H](COc1cc2c(cc1[N+](=O)[O-])OC(F)(F)O2)NC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H24F2N2O7/c1-38-28(35)23(19-39-25-18-27-26(17-24(25)34(36)37)40-30(31,32)41-27)33-29(20-11-5-2-6-12-20,21-13-7-3-8-14-21)22-15-9-4-10-16-22/h2-18,23,33H,19H2,1H3/t23-/m0/s1 |
| InChIKey | FEAMWQPKTOFKAU-QHCPKHFHSA-N |
| XLogP | 5.42 |
| TPSA | 109.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.53 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|