C29H22F2N2O7 — CID 175821817
(2S)-3-[(2,2-difluoro-6-nitro-1,3-benzodioxol-5-yl)oxy]-2-(tritylamino)propanoic acid (PubChem CID 175821817) has the molecular formula C29H22F2N2O7 and a molecular weight of 548.50 g/mol. Its IUPAC name is (2S)-3-[(2,2-difluoro-6-nitro-1,3-benzodioxol-5-yl)oxy]-2-(tritylamino)propanoic acid.
| Compound Name | (2S)-3-[(2,2-difluoro-6-nitro-1,3-benzodioxol-5-yl)oxy]-2-(tritylamino)propanoic acid |
|---|---|
| PubChem CID | 175821817 |
| Molecular Formula | C29H22F2N2O7 |
| Molecular Weight | 548.50 g/mol |
| Exact Mass | 548.14 |
| IUPAC Name | (2S)-3-[(2,2-difluoro-6-nitro-1,3-benzodioxol-5-yl)oxy]-2-(tritylamino)propanoic acid |
| SMILES | O=C(O)[C@H](COc1cc2c(cc1[N+](=O)[O-])OC(F)(F)O2)NC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H22F2N2O7/c30-29(31)39-25-16-23(33(36)37)24(17-26(25)40-29)38-18-22(27(34)35)32-28(19-10-4-1-5-11-19,20-12-6-2-7-13-20)21-14-8-3-9-15-21/h1-17,22,32H,18H2,(H,34,35)/t22-/m0/s1 |
| InChIKey | CHJYJDZVQMVYFL-QFIPXVFZSA-N |
| XLogP | 5.33 |
| TPSA | 120.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.50 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|