C34H28N6O4 — CID 146583443
(2S)-3-[8-[(3-nitro-2-pyridinyl)amino]imidazo[1,2-a]pyridin-5-yl]-2-(tritylamino)propanoic acid (PubChem CID 146583443) has the molecular formula C34H28N6O4 and a molecular weight of 584.64 g/mol. Its IUPAC name is (2S)-3-[8-[(3-nitro-2-pyridinyl)amino]imidazo[1,2-a]pyridin-5-yl]-2-(tritylamino)propanoic acid.
| Compound Name | (2S)-3-[8-[(3-nitro-2-pyridinyl)amino]imidazo[1,2-a]pyridin-5-yl]-2-(tritylamino)propanoic acid |
|---|---|
| PubChem CID | 146583443 |
| Molecular Formula | C34H28N6O4 |
| Molecular Weight | 584.64 g/mol |
| Exact Mass | 584.22 |
| IUPAC Name | (2S)-3-[8-[(3-nitro-2-pyridinyl)amino]imidazo[1,2-a]pyridin-5-yl]-2-(tritylamino)propanoic acid |
| SMILES | O=C(O)[C@H](Cc1ccc(Nc2ncccc2[N+](=O)[O-])c2nccn12)NC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H28N6O4/c41-33(42)29(23-27-18-19-28(32-36-21-22-39(27)32)37-31-30(40(43)44)17-10-20-35-31)38-34(24-11-4-1-5-12-24,25-13-6-2-7-14-25)26-15-8-3-9-16-26/h1-22,29,38H,23H2,(H,35,37)(H,41,42)/t29-/m0/s1 |
| InChIKey | OUVAVGQFVXVCHD-LJAQVGFWSA-N |
| XLogP | 5.96 |
| TPSA | 134.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.64 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|