C41H36N2O6 — CID 18614425
methyl 3-[4-[3-[(2-ethoxy-3,4-dioxocyclobuten-1-yl)amino]phenyl]phenoxy]-2-(tritylamino)propanoate (PubChem CID 18614425) has the molecular formula C41H36N2O6 and a molecular weight of 652.75 g/mol. Its IUPAC name is methyl 3-[4-[3-[(2-ethoxy-3,4-dioxocyclobuten-1-yl)amino]phenyl]phenoxy]-2-(tritylamino)propanoate.
| Compound Name | methyl 3-[4-[3-[(2-ethoxy-3,4-dioxocyclobuten-1-yl)amino]phenyl]phenoxy]-2-(tritylamino)propanoate |
|---|---|
| PubChem CID | 18614425 |
| Molecular Formula | C41H36N2O6 |
| Molecular Weight | 652.75 g/mol |
| Exact Mass | 652.26 |
| IUPAC Name | methyl 3-[4-[3-[(2-ethoxy-3,4-dioxocyclobuten-1-yl)amino]phenyl]phenoxy]-2-(tritylamino)propanoate |
| SMILES | CCOc1c(Nc2cccc(-c3ccc(OCC(NC(c4ccccc4)(c4ccccc4)c4ccccc4)C(=O)OC)cc3)c2)c(=O)c1=O |
| InChI | InChI=1S/C41H36N2O6/c1-3-48-39-36(37(44)38(39)45)42-33-21-13-14-29(26-33)28-22-24-34(25-23-28)49-27-35(40(46)47-2)43-41(30-15-7-4-8-16-30,31-17-9-5-10-18-31)32-19-11-6-12-20-32/h4-26,35,42-43H,3,27H2,1-2H3 |
| InChIKey | AAYBGLOOCOWPRJ-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.75 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|