C35H38BNO5 — CID 66995569
methyl 3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-2-(tritylamino)propanoate (PubChem CID 66995569) has the molecular formula C35H38BNO5 and a molecular weight of 563.50 g/mol. Its IUPAC name is methyl 3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-2-(tritylamino)propanoate.
| Compound Name | methyl 3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-2-(tritylamino)propanoate |
|---|---|
| PubChem CID | 66995569 |
| Molecular Formula | C35H38BNO5 |
| Molecular Weight | 563.50 g/mol |
| Exact Mass | 563.28 |
| IUPAC Name | methyl 3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-2-(tritylamino)propanoate |
| SMILES | COC(=O)C(COc1ccc(B2OC(C)(C)C(C)(C)O2)cc1)NC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H38BNO5/c1-33(2)34(3,4)42-36(41-33)29-21-23-30(24-22-29)40-25-31(32(38)39-5)37-35(26-15-9-6-10-16-26,27-17-11-7-12-18-27)28-19-13-8-14-20-28/h6-24,31,37H,25H2,1-5H3 |
| InChIKey | USRRCOZJXJSISS-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.50 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|