C13H10F3NO3 — CID 18473839
3-ethoxy-4-[3-(trifluoromethyl)anilino]cyclobut-3-ene-1,2-dione (PubChem CID 18473839) has the molecular formula C13H10F3NO3 and a molecular weight of 285.22 g/mol. Its IUPAC name is 3-ethoxy-4-[3-(trifluoromethyl)anilino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-ethoxy-4-[3-(trifluoromethyl)anilino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 18473839 |
| Molecular Formula | C13H10F3NO3 |
| Molecular Weight | 285.22 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 3-ethoxy-4-[3-(trifluoromethyl)anilino]cyclobut-3-ene-1,2-dione |
| SMILES | CCOc1c(Nc2cccc(C(F)(F)F)c2)c(=O)c1=O |
| InChI | InChI=1S/C13H10F3NO3/c1-2-20-12-9(10(18)11(12)19)17-8-5-3-4-7(6-8)13(14,15)16/h3-6,17H,2H2,1H3 |
| InChIKey | DMPWNYWDSNYCHC-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.22 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|