C13H8F5N — CID 82536810
2,6-difluoro-N-[3-(trifluoromethyl)phenyl]aniline (PubChem CID 82536810) has the molecular formula C13H8F5N and a molecular weight of 273.20 g/mol. Its IUPAC name is 2,6-difluoro-N-[3-(trifluoromethyl)phenyl]aniline.
| Compound Name | 2,6-difluoro-N-[3-(trifluoromethyl)phenyl]aniline |
|---|---|
| PubChem CID | 82536810 |
| Molecular Formula | C13H8F5N |
| Molecular Weight | 273.20 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 2,6-difluoro-N-[3-(trifluoromethyl)phenyl]aniline |
| SMILES | Fc1cccc(F)c1Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H8F5N/c14-10-5-2-6-11(15)12(10)19-9-4-1-3-8(7-9)13(16,17)18/h1-7,19H |
| InChIKey | NJAUSRKRVFFWGS-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.20 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |