C17H29NO4 — CID 23471032
1-(tert-butylamino)-3-[2-(2-methoxyethoxymethyl)phenoxy]propan-2-ol (PubChem CID 23471032) has the molecular formula C17H29NO4 and a molecular weight of 311.42 g/mol. Its IUPAC name is 1-(tert-butylamino)-3-[2-(2-methoxyethoxymethyl)phenoxy]propan-2-ol.
| Compound Name | 1-(tert-butylamino)-3-[2-(2-methoxyethoxymethyl)phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 23471032 |
| Molecular Formula | C17H29NO4 |
| Molecular Weight | 311.42 g/mol |
| Exact Mass | 311.21 |
| IUPAC Name | 1-(tert-butylamino)-3-[2-(2-methoxyethoxymethyl)phenoxy]propan-2-ol |
| SMILES | COCCOCc1ccccc1OCC(O)CNC(C)(C)C |
| InChI | InChI=1S/C17H29NO4/c1-17(2,3)18-11-15(19)13-22-16-8-6-5-7-14(16)12-21-10-9-20-4/h5-8,15,18-19H,9-13H2,1-4H3 |
| InChIKey | GEHAETRLYXMHED-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.42 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|