C31H31NO3 — CID 67156552
methyl (2S,3R)-3-phenylmethoxy-2-(tritylamino)butanoate (PubChem CID 67156552) has the molecular formula C31H31NO3 and a molecular weight of 465.59 g/mol. Its IUPAC name is methyl (2S,3R)-3-phenylmethoxy-2-(tritylamino)butanoate.
| Compound Name | methyl (2S,3R)-3-phenylmethoxy-2-(tritylamino)butanoate |
|---|---|
| PubChem CID | 67156552 |
| Molecular Formula | C31H31NO3 |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | methyl (2S,3R)-3-phenylmethoxy-2-(tritylamino)butanoate |
| SMILES | COC(=O)[C@@H](NC(c1ccccc1)(c1ccccc1)c1ccccc1)[C@@H](C)OCc1ccccc1 |
| InChI | InChI=1S/C31H31NO3/c1-24(35-23-25-15-7-3-8-16-25)29(30(33)34-2)32-31(26-17-9-4-10-18-26,27-19-11-5-12-20-27)28-21-13-6-14-22-28/h3-22,24,29,32H,23H2,1-2H3/t24-,29+/m1/s1 |
| InChIKey | FUZHZYQPJZMZCW-GIGWZHCTSA-N |
| XLogP | 5.72 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|