C40H45NO6 — CID 10770354
3-O-benzyl 1-O,1-O-ditert-butyl (3S)-3-(tritylamino)propane-1,1,3-tricarboxylate (PubChem CID 10770354) has the molecular formula C40H45NO6 and a molecular weight of 635.80 g/mol. Its IUPAC name is 3-O-benzyl 1-O,1-O-ditert-butyl (3S)-3-(tritylamino)propane-1,1,3-tricarboxylate.
| Compound Name | 3-O-benzyl 1-O,1-O-ditert-butyl (3S)-3-(tritylamino)propane-1,1,3-tricarboxylate |
|---|---|
| PubChem CID | 10770354 |
| Molecular Formula | C40H45NO6 |
| Molecular Weight | 635.80 g/mol |
| Exact Mass | 635.32 |
| IUPAC Name | 3-O-benzyl 1-O,1-O-ditert-butyl (3S)-3-(tritylamino)propane-1,1,3-tricarboxylate |
| SMILES | CC(C)(C)OC(=O)C(C[C@H](NC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)OCc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C40H45NO6/c1-38(2,3)46-35(42)33(36(43)47-39(4,5)6)27-34(37(44)45-28-29-19-11-7-12-20-29)41-40(30-21-13-8-14-22-30,31-23-15-9-16-24-31)32-25-17-10-18-26-32/h7-26,33-34,41H,27-28H2,1-6H3/t34-/m0/s1 |
| InChIKey | MHBVPSMHJLFNSH-UMSFTDKQSA-N |
| XLogP | 7.37 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.80 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|