C32H34N2O2 — CID 68992813
tert-butyl (2S)-3-anilino-2-(tritylamino)propanoate (PubChem CID 68992813) has the molecular formula C32H34N2O2 and a molecular weight of 478.64 g/mol. Its IUPAC name is tert-butyl (2S)-3-anilino-2-(tritylamino)propanoate.
| Compound Name | tert-butyl (2S)-3-anilino-2-(tritylamino)propanoate |
|---|---|
| PubChem CID | 68992813 |
| Molecular Formula | C32H34N2O2 |
| Molecular Weight | 478.64 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | tert-butyl (2S)-3-anilino-2-(tritylamino)propanoate |
| SMILES | CC(C)(C)OC(=O)[C@H](CNc1ccccc1)NC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H34N2O2/c1-31(2,3)36-30(35)29(24-33-28-22-14-7-15-23-28)34-32(25-16-8-4-9-17-25,26-18-10-5-11-19-26)27-20-12-6-13-21-27/h4-23,29,33-34H,24H2,1-3H3/t29-/m0/s1 |
| InChIKey | ZQLRRIITAPYUPN-LJAQVGFWSA-N |
| XLogP | 6.39 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.64 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|