C45H51NO7S — CID 71468534
ditert-butyl (2S,4S)-2-(3-naphthalen-1-ylsulfonyloxypropyl)-4-(tritylamino)pentanedioate (PubChem CID 71468534) has the molecular formula C45H51NO7S and a molecular weight of 749.97 g/mol. Its IUPAC name is ditert-butyl (2S,4S)-2-(3-naphthalen-1-ylsulfonyloxypropyl)-4-(tritylamino)pentanedioate.
| Compound Name | ditert-butyl (2S,4S)-2-(3-naphthalen-1-ylsulfonyloxypropyl)-4-(tritylamino)pentanedioate |
|---|---|
| PubChem CID | 71468534 |
| Molecular Formula | C45H51NO7S |
| Molecular Weight | 749.97 g/mol |
| Exact Mass | 749.34 |
| IUPAC Name | ditert-butyl (2S,4S)-2-(3-naphthalen-1-ylsulfonyloxypropyl)-4-(tritylamino)pentanedioate |
| SMILES | CC(C)(C)OC(=O)[C@@H](CCCOS(=O)(=O)c1cccc2ccccc12)C[C@H](NC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C45H51NO7S/c1-43(2,3)52-41(47)34(22-19-31-51-54(49,50)40-30-18-21-33-20-16-17-29-38(33)40)32-39(42(48)53-44(4,5)6)46-45(35-23-10-7-11-24-35,36-25-12-8-13-26-36)37-27-14-9-15-28-37/h7-18,20-21,23-30,34,39,46H,19,22,31-32H2,1-6H3/t34-,39-/m0/s1 |
| InChIKey | XNHTUQIBYRFRBK-FPCLRPRSSA-N |
| XLogP | 8.97 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.97 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|