C33H32N2O9S — CID 89120259
(2S,4R)-2-[3-(4-nitrophenyl)sulfonyloxypropyl]-4-(tritylamino)pentanedioic acid (PubChem CID 89120259) has the molecular formula C33H32N2O9S and a molecular weight of 632.69 g/mol. Its IUPAC name is (2S,4R)-2-[3-(4-nitrophenyl)sulfonyloxypropyl]-4-(tritylamino)pentanedioic acid.
| Compound Name | (2S,4R)-2-[3-(4-nitrophenyl)sulfonyloxypropyl]-4-(tritylamino)pentanedioic acid |
|---|---|
| PubChem CID | 89120259 |
| Molecular Formula | C33H32N2O9S |
| Molecular Weight | 632.69 g/mol |
| Exact Mass | 632.18 |
| IUPAC Name | (2S,4R)-2-[3-(4-nitrophenyl)sulfonyloxypropyl]-4-(tritylamino)pentanedioic acid |
| SMILES | O=C(O)[C@@H](CCCOS(=O)(=O)c1ccc([N+](=O)[O-])cc1)C[C@@H](NC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C33H32N2O9S/c36-31(37)24(11-10-22-44-45(42,43)29-20-18-28(19-21-29)35(40)41)23-30(32(38)39)34-33(25-12-4-1-5-13-25,26-14-6-2-7-15-26)27-16-8-3-9-17-27/h1-9,12-21,24,30,34H,10-11,22-23H2,(H,36,37)(H,38,39)/t24-,30+/m0/s1 |
| InChIKey | XVMAETPQTDDSHI-QABMSTFYSA-N |
| XLogP | 5.21 |
| TPSA | 173.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.69 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|