C44H48N2O7S — CID 89136383
1-O-[(E)-but-2-en-2-yl] 5-O-tert-butyl (2S,4S)-2-(3-quinolin-8-ylsulfonyloxypropyl)-4-(tritylamino)pentanedioate (PubChem CID 89136383) has the molecular formula C44H48N2O7S and a molecular weight of 748.94 g/mol. Its IUPAC name is 1-O-[(E)-but-2-en-2-yl] 5-O-tert-butyl (2S,4S)-2-(3-quinolin-8-ylsulfonyloxypropyl)-4-(tritylamino)pentanedioate.
| Compound Name | 1-O-[(E)-but-2-en-2-yl] 5-O-tert-butyl (2S,4S)-2-(3-quinolin-8-ylsulfonyloxypropyl)-4-(tritylamino)pentanedioate |
|---|---|
| PubChem CID | 89136383 |
| Molecular Formula | C44H48N2O7S |
| Molecular Weight | 748.94 g/mol |
| Exact Mass | 748.32 |
| IUPAC Name | 1-O-[(E)-but-2-en-2-yl] 5-O-tert-butyl (2S,4S)-2-(3-quinolin-8-ylsulfonyloxypropyl)-4-(tritylamino)pentanedioate |
| SMILES | C/C=C(\C)OC(=O)[C@@H](CCCOS(=O)(=O)c1cccc2cccnc12)C[C@H](NC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C44H48N2O7S/c1-6-32(2)52-41(47)34(21-18-30-51-54(49,50)39-28-16-19-33-20-17-29-45-40(33)39)31-38(42(48)53-43(3,4)5)46-44(35-22-10-7-11-23-35,36-24-12-8-13-25-36)37-26-14-9-15-27-37/h6-17,19-20,22-29,34,38,46H,18,21,30-31H2,1-5H3/b32-6+/t34-,38-/m0/s1 |
| InChIKey | DMUUABKLZMQKDU-ZFQPSZHCSA-N |
| XLogP | 8.49 |
| TPSA | 120.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.94 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|