C47H53NO7S — CID 78077921
ditert-butyl 2-[3-(4-phenylphenyl)sulfonyloxypropyl]-4-(tritylamino)pentanedioate (PubChem CID 78077921) has the molecular formula C47H53NO7S and a molecular weight of 776.01 g/mol. Its IUPAC name is ditert-butyl 2-[3-(4-phenylphenyl)sulfonyloxypropyl]-4-(tritylamino)pentanedioate.
| Compound Name | ditert-butyl 2-[3-(4-phenylphenyl)sulfonyloxypropyl]-4-(tritylamino)pentanedioate |
|---|---|
| PubChem CID | 78077921 |
| Molecular Formula | C47H53NO7S |
| Molecular Weight | 776.01 g/mol |
| Exact Mass | 775.35 |
| IUPAC Name | ditert-butyl 2-[3-(4-phenylphenyl)sulfonyloxypropyl]-4-(tritylamino)pentanedioate |
| SMILES | CC(C)(C)OC(=O)C(CCCOS(=O)(=O)c1ccc(-c2ccccc2)cc1)CC(NC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C47H53NO7S/c1-45(2,3)54-43(49)37(22-19-33-53-56(51,52)41-31-29-36(30-32-41)35-20-11-7-12-21-35)34-42(44(50)55-46(4,5)6)48-47(38-23-13-8-14-24-38,39-25-15-9-16-26-39)40-27-17-10-18-28-40/h7-18,20-21,23-32,37,42,48H,19,22,33-34H2,1-6H3 |
| InChIKey | WUMDCZQHKSXBQP-UHFFFAOYSA-N |
| XLogP | 9.48 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.01 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|