C17H25N3O8S — CID 88912548
2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoylamino]ethyl 4-nitrobenzenesulfonate (PubChem CID 88912548) has the molecular formula C17H25N3O8S and a molecular weight of 431.47 g/mol. Its IUPAC name is 2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoylamino]ethyl 4-nitrobenzenesulfonate.
| Compound Name | 2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoylamino]ethyl 4-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 88912548 |
| Molecular Formula | C17H25N3O8S |
| Molecular Weight | 431.47 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | 2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoylamino]ethyl 4-nitrobenzenesulfonate |
| SMILES | CC(C)(C)OC(=O)NCCCC(=O)NCCOS(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H25N3O8S/c1-17(2,3)28-16(22)19-10-4-5-15(21)18-11-12-27-29(25,26)14-8-6-13(7-9-14)20(23)24/h6-9H,4-5,10-12H2,1-3H3,(H,18,21)(H,19,22) |
| InChIKey | IMFHKUNCUTWCHT-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 153.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.47 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|